C21H21FN4O — CID 142073924
1-cyclopentyl-6-[(Z)-1-(2-fluorophenyl)-3-nitrosoprop-1-enyl]benzimidazol-2-amine (PubChem CID 142073924) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 1-cyclopentyl-6-[(Z)-1-(2-fluorophenyl)-3-nitrosoprop-1-enyl]benzimidazol-2-amine.
| Compound Name | 1-cyclopentyl-6-[(Z)-1-(2-fluorophenyl)-3-nitrosoprop-1-enyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 142073924 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-cyclopentyl-6-[(Z)-1-(2-fluorophenyl)-3-nitrosoprop-1-enyl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(/C(=C/CN=O)c3ccccc3F)cc2n1C1CCCC1 |
| InChI | InChI=1S/C21H21FN4O/c22-18-8-4-3-7-17(18)16(11-12-24-27)14-9-10-19-20(13-14)26(21(23)25-19)15-5-1-2-6-15/h3-4,7-11,13,15H,1-2,5-6,12H2,(H2,23,25)/b16-11- |
| InChIKey | PBJRPRNMWREXOV-WJDWOHSUSA-N |
| XLogP | 5.07 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |