About ethane;N'-methoxymethanimidamide;1,3-xylene
ethane;N'-methoxymethanimidamide;1,3-xylene (PubChem CID 142083207) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is ethane;N'-methoxymethanimidamide;1,3-xylene.
Molecular Properties
| Compound Name | ethane;N'-methoxymethanimidamide;1,3-xylene |
| PubChem CID | 142083207 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | ethane;N'-methoxymethanimidamide;1,3-xylene |
| SMILES | CC.CO/N=C/N.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C2H6N2O.C2H6/c1-7-4-3-5-8(2)6-7;1-5-4-2-3;1-2/h3-6H,1-2H3;2H,1H3,(H2,3,4);1-2H3 |
| InChIKey | SRMRGZRGVPWHTA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-methoxymethanimidamide;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-methoxymethanimidamide;1,3-xylene?
The IUPAC name of ethane;N'-methoxymethanimidamide;1,3-xylene (CID 142083207) is ethane;N'-methoxymethanimidamide;1,3-xylene.
What is the SMILES notation for ethane;N'-methoxymethanimidamide;1,3-xylene?
The canonical SMILES for ethane;N'-methoxymethanimidamide;1,3-xylene is CC.CO/N=C/N.Cc1cccc(C)c1.
What is the InChIKey of ethane;N'-methoxymethanimidamide;1,3-xylene?
The InChIKey is SRMRGZRGVPWHTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C2H6N2O.C2H6/c1-7-4-3-5-8(2)6-7;1-5-4-2-3;1-2/h3-6H,1-2H3;2H,1H3,(H2,3,4);1-2H3.
What are the key properties of ethane;N'-methoxymethanimidamide;1,3-xylene?
ethane;N'-methoxymethanimidamide;1,3-xylene has a molecular weight of 210.32 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-methoxymethanimidamide;1,3-xylene is sourced from PubChem (CID 142083207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).