C14H16N4O — CID 142106008
2-amino-8-methyl-3-methylideneindeno[2,3-e][1,2,4]triazin-5-one;ethane (PubChem CID 142106008) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-amino-8-methyl-3-methylideneindeno[2,3-e][1,2,4]triazin-5-one;ethane.
| Compound Name | 2-amino-8-methyl-3-methylideneindeno[2,3-e][1,2,4]triazin-5-one;ethane |
|---|---|
| PubChem CID | 142106008 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-amino-8-methyl-3-methylideneindeno[2,3-e][1,2,4]triazin-5-one;ethane |
| SMILES | C=C1N=C2C(=O)c3ccc(C)cc3C2=NN1N.CC |
| InChI | InChI=1S/C12H10N4O.C2H6/c1-6-3-4-8-9(5-6)10-11(12(8)17)14-7(2)16(13)15-10;1-2/h3-5H,2,13H2,1H3;1-2H3 |
| InChIKey | NSUACQKFORFETC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|