C15H30N2 — CID 142113021
N'-[(Z)-but-2-enyl]-N'-methylmethanediamine;cyclohexa-1,3-diene;propane (PubChem CID 142113021) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is N'-[(Z)-but-2-enyl]-N'-methylmethanediamine;cyclohexa-1,3-diene;propane.
| Compound Name | N'-[(Z)-but-2-enyl]-N'-methylmethanediamine;cyclohexa-1,3-diene;propane |
|---|---|
| PubChem CID | 142113021 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N'-[(Z)-but-2-enyl]-N'-methylmethanediamine;cyclohexa-1,3-diene;propane |
| SMILES | C/C=C\CN(C)CN.C1=CCCC=C1.CCC |
| InChI | InChI=1S/C6H14N2.C6H8.C3H8/c1-3-4-5-8(2)6-7;1-2-4-6-5-3-1;1-3-2/h3-4H,5-7H2,1-2H3;1-4H,5-6H2;3H2,1-2H3/b4-3-;; |
| InChIKey | LWVRSJRUJVLNGM-GSBNXNDCSA-N |
| XLogP | 3.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|