C13H19N — CID 142116720
3-methyl-N-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]but-3-en-2-imine (PubChem CID 142116720) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-methyl-N-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]but-3-en-2-imine.
| Compound Name | 3-methyl-N-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]but-3-en-2-imine |
|---|---|
| PubChem CID | 142116720 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-methyl-N-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]but-3-en-2-imine |
| SMILES | C=C/C=C\C(/N=C(\C)C(=C)C)=C(C)C |
| InChI | InChI=1S/C13H19N/c1-7-8-9-13(11(4)5)14-12(6)10(2)3/h7-9H,1-2H2,3-6H3/b9-8-,14-12+ |
| InChIKey | VKXSTZXKPGVSNP-VMXLIBDNSA-N |
| XLogP | 4.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|