About 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene
4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene (PubChem CID 142131498) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene.
Analyze 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene?
The IUPAC name of 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene (CID 142131498) is 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene.
What is the SMILES notation for 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene?
The canonical SMILES for 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene is CC1=CC2C=CC=CC(=C2)C=C1.
What is the InChIKey of 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene?
The InChIKey is FKRJORDOGUALNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12/c1-10-6-7-11-4-2-3-5-12(8-10)9-11/h2-9,12H,1H3.
What are the key properties of 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene?
4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene has a molecular weight of 156.23 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbicyclo[4.4.1]undeca-1(11),2,4,7,9-pentaene is sourced from PubChem (CID 142131498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).