C30H49N5O4 — CID 142134247
1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate;oxolane;1H-pyrimidin-2-one (PubChem CID 142134247) has the molecular formula C30H49N5O4 and a molecular weight of 543.75 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate;oxolane;1H-pyrimidin-2-one.
| Compound Name | 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate;oxolane;1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 142134247 |
| Molecular Formula | C30H49N5O4 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.38 |
| IUPAC Name | 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate;oxolane;1H-pyrimidin-2-one |
| SMILES | C1CCOC1.C=C(CC)NCCCCCCN(Cc1ccccc1)C(=O)OC(C)N(C)C.O=c1nccc[nH]1 |
| InChI | InChI=1S/C22H37N3O2.C4H4N2O.C4H8O/c1-6-19(2)23-16-12-7-8-13-17-25(18-21-14-10-9-11-15-21)22(26)27-20(3)24(4)5;7-4-5-2-1-3-6-4;1-2-4-5-3-1/h9-11,14-15,20,23H,2,6-8,12-13,16-18H2,1,3-5H3;1-3H,(H,5,6,7);1-4H2 |
| InChIKey | AGNOUUIIUXDCFL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|