C14H19NS — CID 142140944
(2Z,4E,7Z)-3-ethenyl-1,6,6-trimethyl-4-(methylideneamino)cycloocta-2,4,7-triene-1-thiol (PubChem CID 142140944) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is (2Z,4E,7Z)-3-ethenyl-1,6,6-trimethyl-4-(methylideneamino)cycloocta-2,4,7-triene-1-thiol.
| Compound Name | (2Z,4E,7Z)-3-ethenyl-1,6,6-trimethyl-4-(methylideneamino)cycloocta-2,4,7-triene-1-thiol |
|---|---|
| PubChem CID | 142140944 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2Z,4E,7Z)-3-ethenyl-1,6,6-trimethyl-4-(methylideneamino)cycloocta-2,4,7-triene-1-thiol |
| SMILES | C=C/C1=C/C(C)(S)/C=C\C(C)(C)C=C1N=C |
| InChI | InChI=1S/C14H19NS/c1-6-11-9-14(4,16)8-7-13(2,3)10-12(11)15-5/h6-10,16H,1,5H2,2-4H3/b8-7-,11-9-,12-10+ |
| InChIKey | QJFORMIBSAPUGO-KGLDOBFESA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|