C7H9ClS2 — CID 142152053
(2S)-2-chloro-5-[(E)-2-methylsulfanylethenyl]-2,3-dihydrothiophene (PubChem CID 142152053) has the molecular formula C7H9ClS2 and a molecular weight of 192.74 g/mol. Its IUPAC name is (2S)-2-chloro-5-[(E)-2-methylsulfanylethenyl]-2,3-dihydrothiophene.
| Compound Name | (2S)-2-chloro-5-[(E)-2-methylsulfanylethenyl]-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 142152053 |
| Molecular Formula | C7H9ClS2 |
| Molecular Weight | 192.74 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | (2S)-2-chloro-5-[(E)-2-methylsulfanylethenyl]-2,3-dihydrothiophene |
| SMILES | CS/C=C/C1=CC[C@H](Cl)S1 |
| InChI | InChI=1S/C7H9ClS2/c1-9-5-4-6-2-3-7(8)10-6/h2,4-5,7H,3H2,1H3/b5-4+/t7-/m1/s1 |
| InChIKey | LVALJLWYOGCGFG-SMMXGFFBSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|