C20H28O3 — CID 142155521
(3R,6S,7E)-6-ethyl-3,7,11-trimethyl-9-methylidene-5,14-dioxabicyclo[11.2.1]hexadeca-1(15),7,13(16)-trien-4-one (PubChem CID 142155521) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3R,6S,7E)-6-ethyl-3,7,11-trimethyl-9-methylidene-5,14-dioxabicyclo[11.2.1]hexadeca-1(15),7,13(16)-trien-4-one.
| Compound Name | (3R,6S,7E)-6-ethyl-3,7,11-trimethyl-9-methylidene-5,14-dioxabicyclo[11.2.1]hexadeca-1(15),7,13(16)-trien-4-one |
|---|---|
| PubChem CID | 142155521 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3R,6S,7E)-6-ethyl-3,7,11-trimethyl-9-methylidene-5,14-dioxabicyclo[11.2.1]hexadeca-1(15),7,13(16)-trien-4-one |
| SMILES | C=C1/C=C(\C)[C@H](CC)OC(=O)[C@H](C)Cc2coc(c2)CC(C)C1 |
| InChI | InChI=1S/C20H28O3/c1-6-19-15(4)8-13(2)7-14(3)9-18-11-17(12-22-18)10-16(5)20(21)23-19/h8,11-12,14,16,19H,2,6-7,9-10H2,1,3-5H3/b15-8+/t14?,16-,19+/m1/s1 |
| InChIKey | OWZLZSQOANEEOH-GBGFXENXSA-N |
| XLogP | 4.86 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |