C20H29ClO5 — CID 20842538
(3R,5S,7E,9S,12E,14S)-7-chloro-14-ethyl-5-hydroxy-5-(hydroxymethyl)-3,9,13-trimethyl-11-methylidene-1-oxacyclotetradeca-7,12-diene-2,4-dione (PubChem CID 20842538) has the molecular formula C20H29ClO5 and a molecular weight of 384.90 g/mol. Its IUPAC name is (3R,5S,7E,9S,12E,14S)-7-chloro-14-ethyl-5-hydroxy-5-(hydroxymethyl)-3,9,13-trimethyl-11-methylidene-1-oxacyclotetradeca-7,12-diene-2,4-dione.
| Compound Name | (3R,5S,7E,9S,12E,14S)-7-chloro-14-ethyl-5-hydroxy-5-(hydroxymethyl)-3,9,13-trimethyl-11-methylidene-1-oxacyclotetradeca-7,12-diene-2,4-dione |
|---|---|
| PubChem CID | 20842538 |
| Molecular Formula | C20H29ClO5 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (3R,5S,7E,9S,12E,14S)-7-chloro-14-ethyl-5-hydroxy-5-(hydroxymethyl)-3,9,13-trimethyl-11-methylidene-1-oxacyclotetradeca-7,12-diene-2,4-dione |
| SMILES | C=C1/C=C(\C)[C@H](CC)OC(=O)[C@H](C)C(=O)[C@@](O)(CO)C/C(Cl)=C\[C@@H](C)C1 |
| InChI | InChI=1S/C20H29ClO5/c1-6-17-14(4)8-12(2)7-13(3)9-16(21)10-20(25,11-22)18(23)15(5)19(24)26-17/h8-9,13,15,17,22,25H,2,6-7,10-11H2,1,3-5H3/b14-8+,16-9+/t13-,15+,17-,20-/m0/s1 |
| InChIKey | CGUZQJIBCFQKJK-IRICKYKRSA-N |
| XLogP | 3.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|