C16H29N — CID 142165813
4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine;ethane (PubChem CID 142165813) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine;ethane.
| Compound Name | 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine;ethane |
|---|---|
| PubChem CID | 142165813 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine;ethane |
| SMILES | C1=CC2CC2C(C2CCNCC2)=C1.CC.CC |
| InChI | InChI=1S/C12H17N.2C2H6/c1-2-10-8-12(10)11(3-1)9-4-6-13-7-5-9;2*1-2/h1-3,9-10,12-13H,4-8H2;2*1-2H3 |
| InChIKey | QBIPAMSWLPNVNI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |