C16H19N3 — CID 142166402
6,7-dimethyl-5,8,15-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9-pentaene (PubChem CID 142166402) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 6,7-dimethyl-5,8,15-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9-pentaene.
| Compound Name | 6,7-dimethyl-5,8,15-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 142166402 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 6,7-dimethyl-5,8,15-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9-pentaene |
| SMILES | Cc1nc2c(nc1C)=CC1CC3CNCC(=C1C=2)C3 |
| InChI | InChI=1S/C16H19N3/c1-9-10(2)19-16-6-14-12(5-15(16)18-9)3-11-4-13(14)8-17-7-11/h5-6,11-12,17H,3-4,7-8H2,1-2H3 |
| InChIKey | OXVLVABSSUKQRR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |