C15H27ClFNO3 — CID 142172574
tert-butyl N-[2-[(Z)-7-chloro-6-fluorohept-5-enoxy]propan-2-yl]carbamate (PubChem CID 142172574) has the molecular formula C15H27ClFNO3 and a molecular weight of 323.84 g/mol. Its IUPAC name is tert-butyl N-[2-[(Z)-7-chloro-6-fluorohept-5-enoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[(Z)-7-chloro-6-fluorohept-5-enoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 142172574 |
| Molecular Formula | C15H27ClFNO3 |
| Molecular Weight | 323.84 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | tert-butyl N-[2-[(Z)-7-chloro-6-fluorohept-5-enoxy]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)OCCCC/C=C(\F)CCl |
| InChI | InChI=1S/C15H27ClFNO3/c1-14(2,3)21-13(19)18-15(4,5)20-10-8-6-7-9-12(17)11-16/h9H,6-8,10-11H2,1-5H3,(H,18,19)/b12-9- |
| InChIKey | HSKPGJFSHOXSJZ-XFXZXTDPSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|