C16H28N2O3 — CID 143824432
tert-butyl N-[2-[[(1Z)-7-methylocta-1,6-dienyl]amino]-2-oxoethyl]carbamate (PubChem CID 143824432) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1Z)-7-methylocta-1,6-dienyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1Z)-7-methylocta-1,6-dienyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 143824432 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | tert-butyl N-[2-[[(1Z)-7-methylocta-1,6-dienyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)=CCCC/C=C\NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-13(2)10-8-6-7-9-11-17-14(19)12-18-15(20)21-16(3,4)5/h9-11H,6-8,12H2,1-5H3,(H,17,19)(H,18,20)/b11-9- |
| InChIKey | FOWKBGSNJFZNAF-LUAWRHEFSA-N |
| XLogP | 3.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|