C9H11IN2 — CID 142173219
2-N'-iodo-1,3-dihydroindene-2,2-diamine (PubChem CID 142173219) has the molecular formula C9H11IN2 and a molecular weight of 274.10 g/mol. Its IUPAC name is 2-N'-iodo-1,3-dihydroindene-2,2-diamine.
| Compound Name | 2-N'-iodo-1,3-dihydroindene-2,2-diamine |
|---|---|
| PubChem CID | 142173219 |
| Molecular Formula | C9H11IN2 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-N'-iodo-1,3-dihydroindene-2,2-diamine |
| SMILES | NC1(NI)Cc2ccccc2C1 |
| InChI | InChI=1S/C9H11IN2/c10-12-9(11)5-7-3-1-2-4-8(7)6-9/h1-4,12H,5-6,11H2 |
| InChIKey | UODCNZOKQHQQDM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|