C17H34BNO2 — CID 142176621
2,3-dimethylpentan-2-yloxy-methoxy-methylborane;(3Z,5Z)-octa-1,3,5-trien-2-amine (PubChem CID 142176621) has the molecular formula C17H34BNO2 and a molecular weight of 295.28 g/mol. Its IUPAC name is 2,3-dimethylpentan-2-yloxy-methoxy-methylborane;(3Z,5Z)-octa-1,3,5-trien-2-amine.
| Compound Name | 2,3-dimethylpentan-2-yloxy-methoxy-methylborane;(3Z,5Z)-octa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142176621 |
| Molecular Formula | C17H34BNO2 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.27 |
| IUPAC Name | 2,3-dimethylpentan-2-yloxy-methoxy-methylborane;(3Z,5Z)-octa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C=C/CC.CCC(C)C(C)(C)OB(C)OC |
| InChI | InChI=1S/C9H21BO2.C8H13N/c1-7-8(2)9(3,4)12-10(5)11-6;1-3-4-5-6-7-8(2)9/h8H,7H2,1-6H3;4-7H,2-3,9H2,1H3/b;5-4-,7-6- |
| InChIKey | PASTXYJZZQVHPK-ZBRBURFXSA-N |
| XLogP | 4.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|