C14H18N — CID 142193938
CID 142193938 (PubChem CID 142193938) has the molecular formula C14H18N and a molecular weight of 200.30 g/mol.
| Compound Name | CID 142193938 |
|---|---|
| PubChem CID | 142193938 |
| Molecular Formula | C14H18N |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | — |
| SMILES | [CH]=C1C(C)CCc2ccc(C)cc2N1C |
| InChI | InChI=1S/C14H18N/c1-10-5-7-13-8-6-11(2)12(3)15(4)14(13)9-10/h3,5,7,9,11H,6,8H2,1-2,4H3 |
| InChIKey | GCSJUABYUYTPJH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |