C12H17N3O — CID 142201014
4-(3-aminophenyl)-4-imino-3,3-dimethylbutanamide (PubChem CID 142201014) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-(3-aminophenyl)-4-imino-3,3-dimethylbutanamide.
| Compound Name | 4-(3-aminophenyl)-4-imino-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 142201014 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-(3-aminophenyl)-4-imino-3,3-dimethylbutanamide |
| SMILES | [H]/N=C(\c1cccc(N)c1)C(C)(C)CC(N)=O |
| InChI | InChI=1S/C12H17N3O/c1-12(2,7-10(14)16)11(15)8-4-3-5-9(13)6-8/h3-6,15H,7,13H2,1-2H3,(H2,14,16)/b15-11+ |
| InChIKey | XRUDPUAENMIROF-RVDMUPIBSA-N |
| XLogP | 1.54 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|