C17H16F3N3O2 — CID 142208914
5-nitro-3-[(2Z,6E)-7-(trifluoromethyl)nona-2,6,8-trienyl]-2H-indazole (PubChem CID 142208914) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 5-nitro-3-[(2Z,6E)-7-(trifluoromethyl)nona-2,6,8-trienyl]-2H-indazole.
| Compound Name | 5-nitro-3-[(2Z,6E)-7-(trifluoromethyl)nona-2,6,8-trienyl]-2H-indazole |
|---|---|
| PubChem CID | 142208914 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-nitro-3-[(2Z,6E)-7-(trifluoromethyl)nona-2,6,8-trienyl]-2H-indazole |
| SMILES | C=C/C(=C\CC/C=C\Cc1[nH]nc2ccc([N+](=O)[O-])cc12)C(F)(F)F |
| InChI | InChI=1S/C17H16F3N3O2/c1-2-12(17(18,19)20)7-5-3-4-6-8-15-14-11-13(23(24)25)9-10-16(14)22-21-15/h2,4,6-7,9-11H,1,3,5,8H2,(H,21,22)/b6-4-,12-7+ |
| InChIKey | XMQZNOIXOXCDQX-YZUXJHQHSA-N |
| XLogP | 5.02 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|