C25H29F3N2O — CID 142248170
2-[[1-cyclopentyl-4-[4-[3-(trifluoromethyl)phenyl]phenyl]piperidin-4-yl]amino]acetaldehyde (PubChem CID 142248170) has the molecular formula C25H29F3N2O and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[[1-cyclopentyl-4-[4-[3-(trifluoromethyl)phenyl]phenyl]piperidin-4-yl]amino]acetaldehyde.
| Compound Name | 2-[[1-cyclopentyl-4-[4-[3-(trifluoromethyl)phenyl]phenyl]piperidin-4-yl]amino]acetaldehyde |
|---|---|
| PubChem CID | 142248170 |
| Molecular Formula | C25H29F3N2O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[[1-cyclopentyl-4-[4-[3-(trifluoromethyl)phenyl]phenyl]piperidin-4-yl]amino]acetaldehyde |
| SMILES | O=CCNC1(c2ccc(-c3cccc(C(F)(F)F)c3)cc2)CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C25H29F3N2O/c26-25(27,28)22-5-3-4-20(18-22)19-8-10-21(11-9-19)24(29-14-17-31)12-15-30(16-13-24)23-6-1-2-7-23/h3-5,8-11,17-18,23,29H,1-2,6-7,12-16H2 |
| InChIKey | XEUNRLGCEXCSQO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|