C10H15NO4 — CID 142261596
2-(methylaminomethoxycarbonyl)bicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 142261596) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(methylaminomethoxycarbonyl)bicyclo[3.1.0]hexane-6-carboxylic acid.
| Compound Name | 2-(methylaminomethoxycarbonyl)bicyclo[3.1.0]hexane-6-carboxylic acid |
|---|---|
| PubChem CID | 142261596 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(methylaminomethoxycarbonyl)bicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | CNCOC(=O)C1CCC2C(C(=O)O)C12 |
| InChI | InChI=1S/C10H15NO4/c1-11-4-15-10(14)6-3-2-5-7(6)8(5)9(12)13/h5-8,11H,2-4H2,1H3,(H,12,13) |
| InChIKey | DVZWIXLIIOCHMW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|