C16H23N3O2 — CID 142277447
1-(5,6-dihydro-1H-indol-3-yl)-2-piperazin-1-ylethane-1,2-dione;ethane (PubChem CID 142277447) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(5,6-dihydro-1H-indol-3-yl)-2-piperazin-1-ylethane-1,2-dione;ethane.
| Compound Name | 1-(5,6-dihydro-1H-indol-3-yl)-2-piperazin-1-ylethane-1,2-dione;ethane |
|---|---|
| PubChem CID | 142277447 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(5,6-dihydro-1H-indol-3-yl)-2-piperazin-1-ylethane-1,2-dione;ethane |
| SMILES | CC.O=C(C(=O)N1CCNCC1)c1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C14H17N3O2.C2H6/c18-13(14(19)17-7-5-15-6-8-17)11-9-16-12-4-2-1-3-10(11)12;1-2/h3-4,9,15-16H,1-2,5-8H2;1-2H3 |
| InChIKey | ABKJNGGYXUAPBQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|