C23H35FO — CID 142281618
2-[[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]methyl]-4-methylpent-4-en-1-ol (PubChem CID 142281618) has the molecular formula C23H35FO and a molecular weight of 346.53 g/mol. Its IUPAC name is 2-[[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]methyl]-4-methylpent-4-en-1-ol.
| Compound Name | 2-[[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]methyl]-4-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 142281618 |
| Molecular Formula | C23H35FO |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-[[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]methyl]-4-methylpent-4-en-1-ol |
| SMILES | C=C(C)CC(CO)Cc1ccc(C2CCC(CCCCF)CC2)cc1 |
| InChI | InChI=1S/C23H35FO/c1-18(2)15-21(17-25)16-20-8-12-23(13-9-20)22-10-6-19(7-11-22)5-3-4-14-24/h8-9,12-13,19,21-22,25H,1,3-7,10-11,14-17H2,2H3 |
| InChIKey | KHCAIYMKKWBWBY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|