C23H28F3NO2 — CID 142283886
(Z)-2-(aminomethyl)-4-(7,8-dihydrophenanthren-2-yl)-4-ethoxy-1,1,1-trifluorobut-3-en-2-ol;ethane (PubChem CID 142283886) has the molecular formula C23H28F3NO2 and a molecular weight of 407.48 g/mol. Its IUPAC name is (Z)-2-(aminomethyl)-4-(7,8-dihydrophenanthren-2-yl)-4-ethoxy-1,1,1-trifluorobut-3-en-2-ol;ethane.
| Compound Name | (Z)-2-(aminomethyl)-4-(7,8-dihydrophenanthren-2-yl)-4-ethoxy-1,1,1-trifluorobut-3-en-2-ol;ethane |
|---|---|
| PubChem CID | 142283886 |
| Molecular Formula | C23H28F3NO2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (Z)-2-(aminomethyl)-4-(7,8-dihydrophenanthren-2-yl)-4-ethoxy-1,1,1-trifluorobut-3-en-2-ol;ethane |
| SMILES | CC.CCO/C(=C\C(O)(CN)C(F)(F)F)c1ccc2c3c(ccc2c1)CCC=C3 |
| InChI | InChI=1S/C21H22F3NO2.C2H6/c1-2-27-19(12-20(26,13-25)21(22,23)24)16-9-10-18-15(11-16)8-7-14-5-3-4-6-17(14)18;1-2/h4,6-12,26H,2-3,5,13,25H2,1H3;1-2H3/b19-12-; |
| InChIKey | GHCCHSZOLKBRHK-JHMJKTBASA-N |
| XLogP | 5.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|