C21H26 — CID 142298206
ethane;molecular hydrogen;tetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),6,9,11,13,15-octaene (PubChem CID 142298206) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is ethane;molecular hydrogen;tetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),6,9,11,13,15-octaene.
| Compound Name | ethane;molecular hydrogen;tetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 142298206 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | ethane;molecular hydrogen;tetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),6,9,11,13,15-octaene |
| SMILES | C1=Cc2cccc3c2C(=CC1)c1ccccc1-3.CC.CC.[H][H] |
| InChI | InChI=1S/C17H12.2C2H6.H2/c1-2-10-15-13-8-3-4-9-14(13)16-11-5-7-12(6-1)17(15)16;2*1-2;/h1,3-11H,2H2;2*1-2H3;1H |
| InChIKey | NOWGYYIZHIZESF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |