C17H22O — CID 143232241
ethane;(3Z,6Z)-3-methyl-8-methylidene-2,5-dihydro-1-benzoxecine (PubChem CID 143232241) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;(3Z,6Z)-3-methyl-8-methylidene-2,5-dihydro-1-benzoxecine.
| Compound Name | ethane;(3Z,6Z)-3-methyl-8-methylidene-2,5-dihydro-1-benzoxecine |
|---|---|
| PubChem CID | 143232241 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | ethane;(3Z,6Z)-3-methyl-8-methylidene-2,5-dihydro-1-benzoxecine |
| SMILES | C=C1/C=C\C/C=C(/C)COc2ccccc21.CC |
| InChI | InChI=1S/C15H16O.C2H6/c1-12-7-3-4-8-13(2)14-9-5-6-10-15(14)16-11-12;1-2/h4-10H,2-3,11H2,1H3;1-2H3/b8-4-,12-7-; |
| InChIKey | VHVGYJYESNWDHN-NWTNQGNXSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|