C18H14 — CID 143566640
6-methyltetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 143566640) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-methyltetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 6-methyltetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 143566640 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-methyltetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | CC1=CCC=C2c3ccccc3-c3cccc1c32 |
| InChI | InChI=1S/C18H14/c1-12-6-4-10-16-14-7-2-3-8-15(14)17-11-5-9-13(12)18(16)17/h2-3,5-11H,4H2,1H3 |
| InChIKey | GUVQWWDKOVJPMG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |