C15H12 — CID 142312566
tetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene (PubChem CID 142312566) has the molecular formula C15H12 and a molecular weight of 192.26 g/mol. Its IUPAC name is tetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene.
| Compound Name | tetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 142312566 |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | tetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene |
| SMILES | C1=c2cc3ccccc3cc2=CC2CC12 |
| InChI | InChI=1S/C15H12/c1-2-4-11-6-13-8-15-9-14(15)7-12(13)5-10(11)3-1/h1-8,14-15H,9H2 |
| InChIKey | NQHGPZNIJUIIMK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |