C20H34N2 — CID 142317481
ethane;N-[(2E)-2-ethenylhepta-2,4-dienyl]methanimine;(3Z)-3-ethenylhexa-3,5-dien-1-amine (PubChem CID 142317481) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is ethane;N-[(2E)-2-ethenylhepta-2,4-dienyl]methanimine;(3Z)-3-ethenylhexa-3,5-dien-1-amine.
| Compound Name | ethane;N-[(2E)-2-ethenylhepta-2,4-dienyl]methanimine;(3Z)-3-ethenylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142317481 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | ethane;N-[(2E)-2-ethenylhepta-2,4-dienyl]methanimine;(3Z)-3-ethenylhexa-3,5-dien-1-amine |
| SMILES | C=C/C(=C\C=CCC)CN=C.C=C/C=C(\C=C)CCN.CC |
| InChI | InChI=1S/C10H15N.C8H13N.C2H6/c1-4-6-7-8-10(5-2)9-11-3;1-3-5-8(4-2)6-7-9;1-2/h5-8H,2-4,9H2,1H3;3-5H,1-2,6-7,9H2;1-2H3/b7-6?,10-8+;8-5+; |
| InChIKey | MLBGMAMYWSKONH-QJRUSYTRSA-N |
| XLogP | 5.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|