C27H46N2 — CID 145061563
ethane;(2E,5Z)-N,N,3,7-tetramethyl-4-methylideneocta-2,5,7-trien-1-amine;(2E,5Z)-N,3,7-trimethyl-4-methylideneocta-2,5,7-trien-1-amine (PubChem CID 145061563) has the molecular formula C27H46N2 and a molecular weight of 398.68 g/mol. Its IUPAC name is ethane;(2E,5Z)-N,N,3,7-tetramethyl-4-methylideneocta-2,5,7-trien-1-amine;(2E,5Z)-N,3,7-trimethyl-4-methylideneocta-2,5,7-trien-1-amine.
| Compound Name | ethane;(2E,5Z)-N,N,3,7-tetramethyl-4-methylideneocta-2,5,7-trien-1-amine;(2E,5Z)-N,3,7-trimethyl-4-methylideneocta-2,5,7-trien-1-amine |
|---|---|
| PubChem CID | 145061563 |
| Molecular Formula | C27H46N2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.37 |
| IUPAC Name | ethane;(2E,5Z)-N,N,3,7-tetramethyl-4-methylideneocta-2,5,7-trien-1-amine;(2E,5Z)-N,3,7-trimethyl-4-methylideneocta-2,5,7-trien-1-amine |
| SMILES | C=C(C)/C=C\C(=C)/C(C)=C/CN(C)C.C=C(C)/C=C\C(=C)/C(C)=C/CNC.CC |
| InChI | InChI=1S/C13H21N.C12H19N.C2H6/c1-11(2)7-8-12(3)13(4)9-10-14(5)6;1-10(2)6-7-11(3)12(4)8-9-13-5;1-2/h7-9H,1,3,10H2,2,4-6H3;6-8,13H,1,3,9H2,2,4-5H3;1-2H3/b8-7-,13-9+;7-6-,12-8+; |
| InChIKey | IRKYUEDGSHINSD-USFVFTAUSA-N |
| XLogP | 7.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|