C15H20N2 — CID 142324465
(2E,4Z)-2-ethenyl-N'-[(E)-2-ethenylbut-2-enyl]-N-methylidenehexa-2,4-dienimidamide (PubChem CID 142324465) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N'-[(E)-2-ethenylbut-2-enyl]-N-methylidenehexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-2-ethenyl-N'-[(E)-2-ethenylbut-2-enyl]-N-methylidenehexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 142324465 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N'-[(E)-2-ethenylbut-2-enyl]-N-methylidenehexa-2,4-dienimidamide |
| SMILES | C=C/C(=C\C)CN=C(N=C)/C(C=C)=C/C=C\C |
| InChI | InChI=1S/C15H20N2/c1-6-10-11-14(9-4)15(16-5)17-12-13(7-2)8-3/h6-11H,2,4-5,12H2,1,3H3/b10-6-,13-8+,14-11+,17-15- |
| InChIKey | WOQYTSRGRBARSO-NCCOZELBSA-N |
| XLogP | 3.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|