C17H36N2S — CID 142349758
butane;ethane;(2Z,4Z)-4-methyl-N'-[(2R)-2-sulfanylbutan-2-yl]hexa-2,4-dienimidamide (PubChem CID 142349758) has the molecular formula C17H36N2S and a molecular weight of 300.56 g/mol. Its IUPAC name is butane;ethane;(2Z,4Z)-4-methyl-N'-[(2R)-2-sulfanylbutan-2-yl]hexa-2,4-dienimidamide.
| Compound Name | butane;ethane;(2Z,4Z)-4-methyl-N'-[(2R)-2-sulfanylbutan-2-yl]hexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 142349758 |
| Molecular Formula | C17H36N2S |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | butane;ethane;(2Z,4Z)-4-methyl-N'-[(2R)-2-sulfanylbutan-2-yl]hexa-2,4-dienimidamide |
| SMILES | C/C=C(C)\C=C/C(N)=N\[C@](C)(S)CC.CC.CCCC |
| InChI | InChI=1S/C11H20N2S.C4H10.C2H6/c1-5-9(3)7-8-10(12)13-11(4,14)6-2;1-3-4-2;1-2/h5,7-8,14H,6H2,1-4H3,(H2,12,13);3-4H2,1-2H3;1-2H3/b8-7-,9-5-;;/t11-;;/m1../s1 |
| InChIKey | RSZFRDGFPKZKBV-XVGYQTKRSA-N |
| XLogP | 5.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|