C18H26 — CID 142357051
(5E,7E,9S)-10-ethenyl-9-prop-2-enyltrideca-1,5,7,12-tetraene (PubChem CID 142357051) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is (5E,7E,9S)-10-ethenyl-9-prop-2-enyltrideca-1,5,7,12-tetraene.
| Compound Name | (5E,7E,9S)-10-ethenyl-9-prop-2-enyltrideca-1,5,7,12-tetraene |
|---|---|
| PubChem CID | 142357051 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (5E,7E,9S)-10-ethenyl-9-prop-2-enyltrideca-1,5,7,12-tetraene |
| SMILES | C=CCC/C=C/C=C/[C@H](CC=C)C(C=C)CC=C |
| InChI | InChI=1S/C18H26/c1-5-9-10-11-12-13-16-18(15-7-3)17(8-4)14-6-2/h5-8,11-13,16-18H,1-4,9-10,14-15H2/b12-11+,16-13+/t17?,18-/m0/s1 |
| InChIKey | LZMKELKTXAVHJW-MIABLFBMSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|