C23H28N3O3+ — CID 142376619
[3-[3-methoxy-2,2-dimethyl-3-oxo-1-(3-oxo-1,2-dihydroinden-5-yl)propyl]-2-methyl-6-(methylamino)phenyl]iminoazanium (PubChem CID 142376619) has the molecular formula C23H28N3O3+ and a molecular weight of 394.50 g/mol. Its IUPAC name is [3-[3-methoxy-2,2-dimethyl-3-oxo-1-(3-oxo-1,2-dihydroinden-5-yl)propyl]-2-methyl-6-(methylamino)phenyl]iminoazanium.
| Compound Name | [3-[3-methoxy-2,2-dimethyl-3-oxo-1-(3-oxo-1,2-dihydroinden-5-yl)propyl]-2-methyl-6-(methylamino)phenyl]iminoazanium |
|---|---|
| PubChem CID | 142376619 |
| Molecular Formula | C23H28N3O3+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [3-[3-methoxy-2,2-dimethyl-3-oxo-1-(3-oxo-1,2-dihydroinden-5-yl)propyl]-2-methyl-6-(methylamino)phenyl]iminoazanium |
| SMILES | CNc1ccc(C(c2ccc3c(c2)C(=O)CC3)C(C)(C)C(=O)OC)c(C)c1N=[NH2+] |
| InChI | InChI=1S/C23H27N3O3/c1-13-16(9-10-18(25-4)21(13)26-24)20(23(2,3)22(28)29-5)15-7-6-14-8-11-19(27)17(14)12-15/h6-7,9-10,12,20,24-25H,8,11H2,1-5H3/p+1 |
| InChIKey | AJYIIWZEJWRKAX-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|