C20H26 — CID 142406851
1,4-dimethyl-2-(3-phenylbut-3-enyl)benzene;ethane (PubChem CID 142406851) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1,4-dimethyl-2-(3-phenylbut-3-enyl)benzene;ethane.
| Compound Name | 1,4-dimethyl-2-(3-phenylbut-3-enyl)benzene;ethane |
|---|---|
| PubChem CID | 142406851 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1,4-dimethyl-2-(3-phenylbut-3-enyl)benzene;ethane |
| SMILES | C=C(CCc1cc(C)ccc1C)c1ccccc1.CC |
| InChI | InChI=1S/C18H20.C2H6/c1-14-9-10-16(3)18(13-14)12-11-15(2)17-7-5-4-6-8-17;1-2/h4-10,13H,2,11-12H2,1,3H3;1-2H3 |
| InChIKey | QNPWUOMUZSAHER-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |