C17H23N — CID 91208052
6-(2,5-dimethylphenyl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine (PubChem CID 91208052) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine.
| Compound Name | 6-(2,5-dimethylphenyl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
|---|---|
| PubChem CID | 91208052 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 6-(2,5-dimethylphenyl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
| SMILES | C=C(CCc1cc(C)ccc1C)C(C)=C/C=N/C |
| InChI | InChI=1S/C17H23N/c1-13-6-7-16(4)17(12-13)9-8-14(2)15(3)10-11-18-5/h6-7,10-12H,2,8-9H2,1,3-5H3/b15-10?,18-11+ |
| InChIKey | WYQYMRZPAJJHPQ-UWVOVALQSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|