C10H14 — CID 142429216
ethene;3-ethynyl-4-methylpenta-1,3-diene (PubChem CID 142429216) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is ethene;3-ethynyl-4-methylpenta-1,3-diene.
| Compound Name | ethene;3-ethynyl-4-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 142429216 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | ethene;3-ethynyl-4-methylpenta-1,3-diene |
| SMILES | C#CC(C=C)=C(C)C.C=C |
| InChI | InChI=1S/C8H10.C2H4/c1-5-8(6-2)7(3)4;1-2/h1,6H,2H2,3-4H3;1-2H2 |
| InChIKey | DXUOFVIUCRFYNN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|