C24H15Cl4F7N4 — CID 142445992
1-[1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]ethenyl]-1-(3,6-dichloropyridazin-4-yl)hydrazine (PubChem CID 142445992) has the molecular formula C24H15Cl4F7N4 and a molecular weight of 634.21 g/mol. Its IUPAC name is 1-[1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]ethenyl]-1-(3,6-dichloropyridazin-4-yl)hydrazine.
| Compound Name | 1-[1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]ethenyl]-1-(3,6-dichloropyridazin-4-yl)hydrazine |
|---|---|
| PubChem CID | 142445992 |
| Molecular Formula | C24H15Cl4F7N4 |
| Molecular Weight | 634.21 g/mol |
| Exact Mass | 631.99 |
| IUPAC Name | 1-[1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]ethenyl]-1-(3,6-dichloropyridazin-4-yl)hydrazine |
| SMILES | C=C(c1ccc(/C(F)=C/C(c2cc(C)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)N(N)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C24H15Cl4F7N4/c1-10-5-13(7-17(25)21(10)27)15(23(30,31)32)8-18(29)12-3-4-14(16(6-12)24(33,34)35)11(2)39(36)19-9-20(26)37-38-22(19)28/h3-9,15H,2,36H2,1H3/b18-8- |
| InChIKey | YJSUMJSSULNSOJ-LSCVHKIXSA-N |
| XLogP | 9.42 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.21 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|