C39H72O2 — CID 142465340
17-(5,5-dimethylhexyl)-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol;3,3,4-trimethylheptan-2-ol (PubChem CID 142465340) has the molecular formula C39H72O2 and a molecular weight of 573.00 g/mol. Its IUPAC name is 17-(5,5-dimethylhexyl)-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol;3,3,4-trimethylheptan-2-ol.
| Compound Name | 17-(5,5-dimethylhexyl)-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol;3,3,4-trimethylheptan-2-ol |
|---|---|
| PubChem CID | 142465340 |
| Molecular Formula | C39H72O2 |
| Molecular Weight | 573.00 g/mol |
| Exact Mass | 572.55 |
| IUPAC Name | 17-(5,5-dimethylhexyl)-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol;3,3,4-trimethylheptan-2-ol |
| SMILES | CC(C)(C)CCCCC1CCC2C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3.CCCC(C)C(C)(C)C(C)O |
| InChI | InChI=1S/C29H50O.C10H22O/c1-26(2,3)17-9-8-10-20-11-13-22-21-12-14-24-27(4,5)25(30)16-19-29(24,7)23(21)15-18-28(20,22)6;1-6-7-8(2)10(4,5)9(3)11/h20,22,24-25,30H,8-19H2,1-7H3;8-9,11H,6-7H2,1-5H3 |
| InChIKey | ODDZVJFGQRQZRJ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.00 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|