C18H20F4N2OSSi — CID 142472435
2-[[5-fluoro-3-[2-(trifluoromethyl)thiophen-3-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142472435) has the molecular formula C18H20F4N2OSSi and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[[5-fluoro-3-[2-(trifluoromethyl)thiophen-3-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-fluoro-3-[2-(trifluoromethyl)thiophen-3-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142472435 |
| Molecular Formula | C18H20F4N2OSSi |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[[5-fluoro-3-[2-(trifluoromethyl)thiophen-3-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccsc2C(F)(F)F)c2cc(F)cnc21 |
| InChI | InChI=1S/C18H20F4N2OSSi/c1-27(2,3)7-5-25-11-24-10-15(14-8-12(19)9-23-17(14)24)13-4-6-26-16(13)18(20,21)22/h4,6,8-10H,5,7,11H2,1-3H3 |
| InChIKey | ZPUKLCQXNDPQKH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|