C20H19NO3 — CID 142482266
2-[(3,3-dimethyl-2-oxobutyl)amino]phenanthrene-9,10-dione (PubChem CID 142482266) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[(3,3-dimethyl-2-oxobutyl)amino]phenanthrene-9,10-dione.
| Compound Name | 2-[(3,3-dimethyl-2-oxobutyl)amino]phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 142482266 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[(3,3-dimethyl-2-oxobutyl)amino]phenanthrene-9,10-dione |
| SMILES | CC(C)(C)C(=O)CNc1ccc2c(c1)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H19NO3/c1-20(2,3)17(22)11-21-12-8-9-14-13-6-4-5-7-15(13)18(23)19(24)16(14)10-12/h4-10,21H,11H2,1-3H3 |
| InChIKey | FMHUPLGLBNQYLK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|