C9H15F5O2 — CID 142492601
1,3-bis(2,3-difluoropropoxy)-2-fluoropropane (PubChem CID 142492601) has the molecular formula C9H15F5O2 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1,3-bis(2,3-difluoropropoxy)-2-fluoropropane.
| Compound Name | 1,3-bis(2,3-difluoropropoxy)-2-fluoropropane |
|---|---|
| PubChem CID | 142492601 |
| Molecular Formula | C9H15F5O2 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1,3-bis(2,3-difluoropropoxy)-2-fluoropropane |
| SMILES | FCC(F)COCC(F)COCC(F)CF |
| InChI | InChI=1S/C9H15F5O2/c10-1-7(12)3-15-5-9(14)6-16-4-8(13)2-11/h7-9H,1-6H2 |
| InChIKey | QHWJTWVAQXLEMV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |