C38H56N4 — CID 142511190
(2E)-1-[4-cyclopropylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511190) has the molecular formula C38H56N4 and a molecular weight of 568.89 g/mol. Its IUPAC name is (2E)-1-[4-cyclopropylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (2E)-1-[4-cyclopropylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511190 |
| Molecular Formula | C38H56N4 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.45 |
| IUPAC Name | (2E)-1-[4-cyclopropylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CC2)N2C=C(C3=CC(C)(C)NC(C)(C)C3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C28H36N4.C10H20/c1-18(2)19(3)13-23(29-8)24-14-25(20-9-10-20)32-17-21(11-12-26(32)30-24)22-15-27(4,5)31-28(6,7)16-22;1-5-7-8-10(4)9(3)6-2/h11-15,17,31H,1,9-10,16H2,2-8H3;8-9H,5-7H2,1-4H3/b19-13+,29-23+;10-8- |
| InChIKey | VKJIZVWNNLOVOM-LMGUAIDESA-N |
| XLogP | 9.94 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|