C23H27N3 — CID 142511350
2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine (PubChem CID 142511350) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine.
| Compound Name | 2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142511350 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine |
| SMILES | C=C(C)/C(C)=C/C(=C\C)C1=CC(=C)N2C=C(C3=CCNCC3)C=CC2=N1 |
| InChI | InChI=1S/C23H27N3/c1-6-19(13-17(4)16(2)3)22-14-18(5)26-15-21(7-8-23(26)25-22)20-9-11-24-12-10-20/h6-9,13-15,24H,2,5,10-12H2,1,3-4H3/b17-13+,19-6+ |
| InChIKey | JADOCNRHGDELKS-NOCJFZBJSA-N |
| XLogP | 4.94 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|