C16H13F4N3O — CID 142514989
2-cyclopropyl-2-[(5S,7S)-7-fluoro-5-(2,3,6-trifluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethenone (PubChem CID 142514989) has the molecular formula C16H13F4N3O and a molecular weight of 339.29 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(5S,7S)-7-fluoro-5-(2,3,6-trifluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethenone.
| Compound Name | 2-cyclopropyl-2-[(5S,7S)-7-fluoro-5-(2,3,6-trifluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethenone |
|---|---|
| PubChem CID | 142514989 |
| Molecular Formula | C16H13F4N3O |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-cyclopropyl-2-[(5S,7S)-7-fluoro-5-(2,3,6-trifluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethenone |
| SMILES | O=C=C(c1nc2n(n1)[C@H](C1C(F)=C(F)C=CC1F)C[C@@H]2F)C1CC1 |
| InChI | InChI=1S/C16H13F4N3O/c17-9-3-4-10(18)14(20)13(9)12-5-11(19)16-21-15(22-23(12)16)8(6-24)7-1-2-7/h3-4,7,9,11-13H,1-2,5H2/t9?,11-,12-,13?/m0/s1 |
| InChIKey | JGJXKZATCDNUKR-FHQIDYJMSA-N |
| XLogP | 3.53 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|