C13H13F3O3 — CID 142550431
ethyl 3-(2,4,6-trifluorophenoxy)cyclobutane-1-carboxylate (PubChem CID 142550431) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is ethyl 3-(2,4,6-trifluorophenoxy)cyclobutane-1-carboxylate.
| Compound Name | ethyl 3-(2,4,6-trifluorophenoxy)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 142550431 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 3-(2,4,6-trifluorophenoxy)cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(Oc2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C13H13F3O3/c1-2-18-13(17)7-3-9(4-7)19-12-10(15)5-8(14)6-11(12)16/h5-7,9H,2-4H2,1H3 |
| InChIKey | WYYMSXZZYSRPBJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |