C17H26N6OS3 — CID 142557440
methanethiol;4-[[2-[methyl(methylsulfanyl)amino]-4-pyridinyl]amino]-2-methylsulfanyl-N-propan-2-ylpyrimidine-5-carboxamide (PubChem CID 142557440) has the molecular formula C17H26N6OS3 and a molecular weight of 426.64 g/mol. Its IUPAC name is methanethiol;4-[[2-[methyl(methylsulfanyl)amino]-4-pyridinyl]amino]-2-methylsulfanyl-N-propan-2-ylpyrimidine-5-carboxamide.
| Compound Name | methanethiol;4-[[2-[methyl(methylsulfanyl)amino]-4-pyridinyl]amino]-2-methylsulfanyl-N-propan-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142557440 |
| Molecular Formula | C17H26N6OS3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | methanethiol;4-[[2-[methyl(methylsulfanyl)amino]-4-pyridinyl]amino]-2-methylsulfanyl-N-propan-2-ylpyrimidine-5-carboxamide |
| SMILES | CS.CSc1ncc(C(=O)NC(C)C)c(Nc2ccnc(N(C)SC)c2)n1 |
| InChI | InChI=1S/C16H22N6OS2.CH4S/c1-10(2)19-15(23)12-9-18-16(24-4)21-14(12)20-11-6-7-17-13(8-11)22(3)25-5;1-2/h6-10H,1-5H3,(H,19,23)(H,17,18,20,21);2H,1H3 |
| InChIKey | JJGBMBDRGAKBIK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|