C10H17N — CID 142585371
(2Z,4E)-N-methyl-2-propan-2-ylhexa-2,4-dien-1-imine (PubChem CID 142585371) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z,4E)-N-methyl-2-propan-2-ylhexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-N-methyl-2-propan-2-ylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142585371 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z,4E)-N-methyl-2-propan-2-ylhexa-2,4-dien-1-imine |
| SMILES | C/C=C/C=C(\C=N\C)C(C)C |
| InChI | InChI=1S/C10H17N/c1-5-6-7-10(8-11-4)9(2)3/h5-9H,1-4H3/b6-5+,10-7+,11-8+ |
| InChIKey | AISPNSKAOVSNAD-CQBDNMEGSA-N |
| XLogP | 2.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|