C19H17F3N4O — CID 142606609
N'-[1-methyl-6-[(E)-prop-1-enyl]indazol-3-yl]-4-(trifluoromethoxy)benzenecarboximidamide (PubChem CID 142606609) has the molecular formula C19H17F3N4O and a molecular weight of 374.37 g/mol. Its IUPAC name is N'-[1-methyl-6-[(E)-prop-1-enyl]indazol-3-yl]-4-(trifluoromethoxy)benzenecarboximidamide.
| Compound Name | N'-[1-methyl-6-[(E)-prop-1-enyl]indazol-3-yl]-4-(trifluoromethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 142606609 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N'-[1-methyl-6-[(E)-prop-1-enyl]indazol-3-yl]-4-(trifluoromethoxy)benzenecarboximidamide |
| SMILES | C/C=C/c1ccc2c(/N=C(\N)c3ccc(OC(F)(F)F)cc3)nn(C)c2c1 |
| InChI | InChI=1S/C19H17F3N4O/c1-3-4-12-5-10-15-16(11-12)26(2)25-18(15)24-17(23)13-6-8-14(9-7-13)27-19(20,21)22/h3-11H,1-2H3,(H2,23,24,25)/b4-3+ |
| InChIKey | JQTBTLQVYPPOEJ-ONEGZZNKSA-N |
| XLogP | 4.54 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|